C15H17ClN2O4 — CID 7827370
[2-(cyclopropylamino)-2-oxoethyl] 3-[(4-chlorobenzoyl)amino]propanoate (PubChem CID 7827370) has the molecular formula C15H17ClN2O4 and a molecular weight of 324.76 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 3-[(4-chlorobenzoyl)amino]propanoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 3-[(4-chlorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7827370 |
| Molecular Formula | C15H17ClN2O4 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 3-[(4-chlorobenzoyl)amino]propanoate |
| SMILES | O=C(COC(=O)CCNC(=O)c1ccc(Cl)cc1)NC1CC1 |
| InChI | InChI=1S/C15H17ClN2O4/c16-11-3-1-10(2-4-11)15(21)17-8-7-14(20)22-9-13(19)18-12-5-6-12/h1-4,12H,5-9H2,(H,17,21)(H,18,19) |
| InChIKey | ULUPESJOTOHIKW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |