C14H17ClN2O4 — CID 4795054
[2-(methylamino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate (PubChem CID 4795054) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 4795054 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
| SMILES | CNC(=O)COC(=O)CCCNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H17ClN2O4/c1-16-12(18)9-21-13(19)3-2-8-17-14(20)10-4-6-11(15)7-5-10/h4-7H,2-3,8-9H2,1H3,(H,16,18)(H,17,20) |
| InChIKey | ZXHVGYQQQMBINJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|