C21H29ClN2O4 — CID 42965668
[2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate (PubChem CID 42965668) has the molecular formula C21H29ClN2O4 and a molecular weight of 408.93 g/mol. Its IUPAC name is [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate.
| Compound Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 42965668 |
| Molecular Formula | C21H29ClN2O4 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
| SMILES | CCN(C(=O)COC(=O)CCCNC(=O)c1ccc(Cl)cc1)C1CCCCC1 |
| InChI | InChI=1S/C21H29ClN2O4/c1-2-24(18-7-4-3-5-8-18)19(25)15-28-20(26)9-6-14-23-21(27)16-10-12-17(22)13-11-16/h10-13,18H,2-9,14-15H2,1H3,(H,23,27) |
| InChIKey | QWOXFMJUBNFYMV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|