C25H30N2O5 — CID 42012351
[2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 2-[(4-phenoxybenzoyl)amino]acetate (PubChem CID 42012351) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 2-[(4-phenoxybenzoyl)amino]acetate.
| Compound Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 2-[(4-phenoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 42012351 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [2-[cyclohexyl(ethyl)amino]-2-oxoethyl] 2-[(4-phenoxybenzoyl)amino]acetate |
| SMILES | CCN(C(=O)COC(=O)CNC(=O)c1ccc(Oc2ccccc2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C25H30N2O5/c1-2-27(20-9-5-3-6-10-20)23(28)18-31-24(29)17-26-25(30)19-13-15-22(16-14-19)32-21-11-7-4-8-12-21/h4,7-8,11-16,20H,2-3,5-6,9-10,17-18H2,1H3,(H,26,30) |
| InChIKey | QBASDUUFAUDMTK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |