C21H30N2O7S — CID 41183838
[2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 2-[(4-butoxybenzoyl)amino]acetate (PubChem CID 41183838) has the molecular formula C21H30N2O7S and a molecular weight of 454.55 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 2-[(4-butoxybenzoyl)amino]acetate.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 2-[(4-butoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 41183838 |
| Molecular Formula | C21H30N2O7S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]-ethylamino]-2-oxoethyl] 2-[(4-butoxybenzoyl)amino]acetate |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)OCC(=O)N(CC)[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C21H30N2O7S/c1-3-5-11-29-18-8-6-16(7-9-18)21(26)22-13-20(25)30-14-19(24)23(4-2)17-10-12-31(27,28)15-17/h6-9,17H,3-5,10-15H2,1-2H3,(H,22,26)/t17-/m1/s1 |
| InChIKey | BGTYIEXLPRLXKQ-QGZVFWFLSA-N |
| XLogP | 1.17 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|