C23H32N2O4 — CID 3593681
[2-(dicyclohexylamino)-2-oxoethyl] 2-benzamidoacetate (PubChem CID 3593681) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is [2-(dicyclohexylamino)-2-oxoethyl] 2-benzamidoacetate.
| Compound Name | [2-(dicyclohexylamino)-2-oxoethyl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 3593681 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | [2-(dicyclohexylamino)-2-oxoethyl] 2-benzamidoacetate |
| SMILES | O=C(CNC(=O)c1ccccc1)OCC(=O)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C23H32N2O4/c26-21(17-29-22(27)16-24-23(28)18-10-4-1-5-11-18)25(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1,4-5,10-11,19-20H,2-3,6-9,12-17H2,(H,24,28) |
| InChIKey | ZRACEOSPEISMRB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |