C19H27N2O3+ — CID 11898479
[(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2-benzamidoacetate (PubChem CID 11898479) has the molecular formula C19H27N2O3+ and a molecular weight of 331.44 g/mol. Its IUPAC name is [(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2-benzamidoacetate.
| Compound Name | [(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2-benzamidoacetate |
|---|---|
| PubChem CID | 11898479 |
| Molecular Formula | C19H27N2O3+ |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | [(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2-benzamidoacetate |
| SMILES | O=C(CNC(=O)c1ccccc1)OC[C@H]1CCC[NH+]2CCCC[C@H]12 |
| InChI | InChI=1S/C19H26N2O3/c22-18(13-20-19(23)15-7-2-1-3-8-15)24-14-16-9-6-12-21-11-5-4-10-17(16)21/h1-3,7-8,16-17H,4-6,9-14H2,(H,20,23)/p+1/t16-,17-/m1/s1 |
| InChIKey | HOXLEEYZWFUSMS-IAGOWNOFSA-O |
| XLogP | 0.81 |
| TPSA | 59.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |