C17H22F2NO2+ — CID 11894457
[(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 3,4-difluorobenzoate (PubChem CID 11894457) has the molecular formula C17H22F2NO2+ and a molecular weight of 310.36 g/mol. Its IUPAC name is [(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 3,4-difluorobenzoate.
| Compound Name | [(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 3,4-difluorobenzoate |
|---|---|
| PubChem CID | 11894457 |
| Molecular Formula | C17H22F2NO2+ |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | [(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 3,4-difluorobenzoate |
| SMILES | O=C(OC[C@H]1CCC[NH+]2CCCC[C@H]12)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H21F2NO2/c18-14-7-6-12(10-15(14)19)17(21)22-11-13-4-3-9-20-8-2-1-5-16(13)20/h6-7,10,13,16H,1-5,8-9,11H2/p+1/t13-,16-/m1/s1 |
| InChIKey | CANUBXZJGLXAEB-CZUORRHYSA-O |
| XLogP | 1.97 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |