C20H30NO2+ — CID 11909239
[(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2,4,6-trimethylbenzoate (PubChem CID 11909239) has the molecular formula C20H30NO2+ and a molecular weight of 316.47 g/mol. Its IUPAC name is [(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2,4,6-trimethylbenzoate.
| Compound Name | [(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 11909239 |
| Molecular Formula | C20H30NO2+ |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.23 |
| IUPAC Name | [(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OC[C@H]2CCC[NH+]3CCCC[C@H]23)c(C)c1 |
| InChI | InChI=1S/C20H29NO2/c1-14-11-15(2)19(16(3)12-14)20(22)23-13-17-7-6-10-21-9-5-4-8-18(17)21/h11-12,17-18H,4-10,13H2,1-3H3/p+1/t17-,18-/m1/s1 |
| InChIKey | XKNGNLUBHDCEQV-QZTJIDSGSA-O |
| XLogP | 2.62 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |