C18H26NO3+ — CID 6942190
[(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 4-methoxybenzoate (PubChem CID 6942190) has the molecular formula C18H26NO3+ and a molecular weight of 304.41 g/mol. Its IUPAC name is [(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 4-methoxybenzoate.
| Compound Name | [(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 4-methoxybenzoate |
|---|---|
| PubChem CID | 6942190 |
| Molecular Formula | C18H26NO3+ |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | [(1S,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC[C@H]2CCC[NH+]3CCCC[C@H]23)cc1 |
| InChI | InChI=1S/C18H25NO3/c1-21-16-9-7-14(8-10-16)18(20)22-13-15-5-4-12-19-11-3-2-6-17(15)19/h7-10,15,17H,2-6,11-13H2,1H3/p+1/t15-,17-/m1/s1 |
| InChIKey | VXDPQMMZUVIUEI-NVXWUHKLSA-O |
| XLogP | 1.70 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |