C17H24NO2+ — CID 6939222
[(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl benzoate (PubChem CID 6939222) has the molecular formula C17H24NO2+ and a molecular weight of 274.38 g/mol. Its IUPAC name is [(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl benzoate.
| Compound Name | [(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 6939222 |
| Molecular Formula | C17H24NO2+ |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | [(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1CCC[NH+]2CCCC[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C17H23NO2/c19-17(14-7-2-1-3-8-14)20-13-15-9-6-12-18-11-5-4-10-16(15)18/h1-3,7-8,15-16H,4-6,9-13H2/p+1/t15-,16+/m1/s1 |
| InChIKey | OFWRWKIOGHBYNK-CVEARBPZSA-O |
| XLogP | 1.69 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |