C20H30NO3+ — CID 7078238
2-[(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]ethyl 4-ethoxybenzoate (PubChem CID 7078238) has the molecular formula C20H30NO3+ and a molecular weight of 332.46 g/mol. Its IUPAC name is 2-[(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]ethyl 4-ethoxybenzoate.
| Compound Name | 2-[(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]ethyl 4-ethoxybenzoate |
|---|---|
| PubChem CID | 7078238 |
| Molecular Formula | C20H30NO3+ |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 2-[(1R,9aR)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]ethyl 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC[C@H]2CCC[NH+]3CCCC[C@H]23)cc1 |
| InChI | InChI=1S/C20H29NO3/c1-2-23-18-10-8-17(9-11-18)20(22)24-15-12-16-6-5-14-21-13-4-3-7-19(16)21/h8-11,16,19H,2-7,12-15H2,1H3/p+1/t16-,19-/m1/s1 |
| InChIKey | LMVFSJKEPVNMKH-VQIMIIECSA-O |
| XLogP | 2.48 |
| TPSA | 39.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |