C49H76O6 — CID 67826028
[(2R)-2-[4-[3-(2-heptylcyclohexyl)propoxy]benzoyl]oxypropyl] 4-[3-(2-heptylcyclohexyl)propoxy]benzoate (PubChem CID 67826028) has the molecular formula C49H76O6 and a molecular weight of 761.14 g/mol. Its IUPAC name is [(2R)-2-[4-[3-(2-heptylcyclohexyl)propoxy]benzoyl]oxypropyl] 4-[3-(2-heptylcyclohexyl)propoxy]benzoate.
| Compound Name | [(2R)-2-[4-[3-(2-heptylcyclohexyl)propoxy]benzoyl]oxypropyl] 4-[3-(2-heptylcyclohexyl)propoxy]benzoate |
|---|---|
| PubChem CID | 67826028 |
| Molecular Formula | C49H76O6 |
| Molecular Weight | 761.14 g/mol |
| Exact Mass | 760.56 |
| IUPAC Name | [(2R)-2-[4-[3-(2-heptylcyclohexyl)propoxy]benzoyl]oxypropyl] 4-[3-(2-heptylcyclohexyl)propoxy]benzoate |
| SMILES | CCCCCCCC1CCCCC1CCCOc1ccc(C(=O)OC[C@@H](C)OC(=O)c2ccc(OCCCC3CCCCC3CCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C49H76O6/c1-4-6-8-10-12-20-40-22-14-16-24-42(40)26-18-36-52-46-32-28-44(29-33-46)48(50)54-38-39(3)55-49(51)45-30-34-47(35-31-45)53-37-19-27-43-25-17-15-23-41(43)21-13-11-9-7-5-2/h28-35,39-43H,4-27,36-38H2,1-3H3/t39-,40?,41?,42?,43?/m1/s1 |
| InChIKey | ZEYMNIYQRYCYJS-YYQVHNQHSA-N |
| XLogP | 13.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.14 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|