C42H62O6 — CID 67784931
[(2R,3R)-3-[4-[3-(2-propylcyclohexyl)propoxy]benzoyl]oxybutan-2-yl] 4-[3-(2-propylcyclohexyl)propoxy]benzoate (PubChem CID 67784931) has the molecular formula C42H62O6 and a molecular weight of 662.95 g/mol. Its IUPAC name is [(2R,3R)-3-[4-[3-(2-propylcyclohexyl)propoxy]benzoyl]oxybutan-2-yl] 4-[3-(2-propylcyclohexyl)propoxy]benzoate.
| Compound Name | [(2R,3R)-3-[4-[3-(2-propylcyclohexyl)propoxy]benzoyl]oxybutan-2-yl] 4-[3-(2-propylcyclohexyl)propoxy]benzoate |
|---|---|
| PubChem CID | 67784931 |
| Molecular Formula | C42H62O6 |
| Molecular Weight | 662.95 g/mol |
| Exact Mass | 662.45 |
| IUPAC Name | [(2R,3R)-3-[4-[3-(2-propylcyclohexyl)propoxy]benzoyl]oxybutan-2-yl] 4-[3-(2-propylcyclohexyl)propoxy]benzoate |
| SMILES | CCCC1CCCCC1CCCOc1ccc(C(=O)O[C@H](C)[C@@H](C)OC(=O)c2ccc(OCCCC3CCCCC3CCC)cc2)cc1 |
| InChI | InChI=1S/C42H62O6/c1-5-13-33-15-7-9-17-35(33)19-11-29-45-39-25-21-37(22-26-39)41(43)47-31(3)32(4)48-42(44)38-23-27-40(28-24-38)46-30-12-20-36-18-10-8-16-34(36)14-6-2/h21-28,31-36H,5-20,29-30H2,1-4H3/t31-,32-,33?,34?,35?,36?/m1/s1 |
| InChIKey | DUCBLCXVBIWYRF-AAGWKZJCSA-N |
| XLogP | 11.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.95 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|