C20H32O2 — CID 57301084
1-ethoxy-4-[3-(2-propylcyclohexyl)propoxy]benzene (PubChem CID 57301084) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 1-ethoxy-4-[3-(2-propylcyclohexyl)propoxy]benzene.
| Compound Name | 1-ethoxy-4-[3-(2-propylcyclohexyl)propoxy]benzene |
|---|---|
| PubChem CID | 57301084 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 1-ethoxy-4-[3-(2-propylcyclohexyl)propoxy]benzene |
| SMILES | CCCC1CCCCC1CCCOc1ccc(OCC)cc1 |
| InChI | InChI=1S/C20H32O2/c1-3-8-17-9-5-6-10-18(17)11-7-16-22-20-14-12-19(13-15-20)21-4-2/h12-15,17-18H,3-11,16H2,1-2H3 |
| InChIKey | NTTVSMXSHUVFOO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|