C24H36N2O2S — CID 57018319
2-(4-ethoxyphenyl)-5-[3-(2-pentylcyclohexyl)propoxy]-1,3,4-thiadiazole (PubChem CID 57018319) has the molecular formula C24H36N2O2S and a molecular weight of 416.63 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-5-[3-(2-pentylcyclohexyl)propoxy]-1,3,4-thiadiazole.
| Compound Name | 2-(4-ethoxyphenyl)-5-[3-(2-pentylcyclohexyl)propoxy]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 57018319 |
| Molecular Formula | C24H36N2O2S |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 2-(4-ethoxyphenyl)-5-[3-(2-pentylcyclohexyl)propoxy]-1,3,4-thiadiazole |
| SMILES | CCCCCC1CCCCC1CCCOc1nnc(-c2ccc(OCC)cc2)s1 |
| InChI | InChI=1S/C24H36N2O2S/c1-3-5-6-10-19-11-7-8-12-20(19)13-9-18-28-24-26-25-23(29-24)21-14-16-22(17-15-21)27-4-2/h14-17,19-20H,3-13,18H2,1-2H3 |
| InChIKey | KFHNVUSWPPWOTI-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|