C27H42N2OS — CID 19739061
2-pentyl-5-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]-1,3,4-thiadiazole (PubChem CID 19739061) has the molecular formula C27H42N2OS and a molecular weight of 442.71 g/mol. Its IUPAC name is 2-pentyl-5-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]-1,3,4-thiadiazole.
| Compound Name | 2-pentyl-5-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 19739061 |
| Molecular Formula | C27H42N2OS |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | 2-pentyl-5-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]-1,3,4-thiadiazole |
| SMILES | CCCCCc1nnc(-c2ccc(OCCCC3CCC(CCCCC)CC3)cc2)s1 |
| InChI | InChI=1S/C27H42N2OS/c1-3-5-7-10-22-13-15-23(16-14-22)11-9-21-30-25-19-17-24(18-20-25)27-29-28-26(31-27)12-8-6-4-2/h17-20,22-23H,3-16,21H2,1-2H3 |
| InChIKey | LEUUYXQRRJNYPZ-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|