C23H36N2OS — CID 18997783
2-(4-decoxyphenyl)-5-pentyl-1,3,4-thiadiazole (PubChem CID 18997783) has the molecular formula C23H36N2OS and a molecular weight of 388.62 g/mol. Its IUPAC name is 2-(4-decoxyphenyl)-5-pentyl-1,3,4-thiadiazole.
| Compound Name | 2-(4-decoxyphenyl)-5-pentyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 18997783 |
| Molecular Formula | C23H36N2OS |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 2-(4-decoxyphenyl)-5-pentyl-1,3,4-thiadiazole |
| SMILES | CCCCCCCCCCOc1ccc(-c2nnc(CCCCC)s2)cc1 |
| InChI | InChI=1S/C23H36N2OS/c1-3-5-7-8-9-10-11-13-19-26-21-17-15-20(16-18-21)23-25-24-22(27-23)14-12-6-4-2/h15-18H,3-14,19H2,1-2H3 |
| InChIKey | BUTWUQCSEQSEKW-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|