C25H34N4S — CID 19979815
2-[4-(5-heptylpyrimidin-2-yl)phenyl]-5-hexyl-1,3,4-thiadiazole (PubChem CID 19979815) has the molecular formula C25H34N4S and a molecular weight of 422.64 g/mol. Its IUPAC name is 2-[4-(5-heptylpyrimidin-2-yl)phenyl]-5-hexyl-1,3,4-thiadiazole.
| Compound Name | 2-[4-(5-heptylpyrimidin-2-yl)phenyl]-5-hexyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 19979815 |
| Molecular Formula | C25H34N4S |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 2-[4-(5-heptylpyrimidin-2-yl)phenyl]-5-hexyl-1,3,4-thiadiazole |
| SMILES | CCCCCCCc1cnc(-c2ccc(-c3nnc(CCCCCC)s3)cc2)nc1 |
| InChI | InChI=1S/C25H34N4S/c1-3-5-7-9-10-12-20-18-26-24(27-19-20)21-14-16-22(17-15-21)25-29-28-23(30-25)13-11-8-6-4-2/h14-19H,3-13H2,1-2H3 |
| InChIKey | OGTZJKNOOAKIOQ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|