C26H32N2OS — CID 54061444
2-[4-(4-hept-2-enoxyphenyl)phenyl]-5-pentyl-1,3,4-thiadiazole (PubChem CID 54061444) has the molecular formula C26H32N2OS and a molecular weight of 420.62 g/mol. Its IUPAC name is 2-[4-(4-hept-2-enoxyphenyl)phenyl]-5-pentyl-1,3,4-thiadiazole.
| Compound Name | 2-[4-(4-hept-2-enoxyphenyl)phenyl]-5-pentyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 54061444 |
| Molecular Formula | C26H32N2OS |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 2-[4-(4-hept-2-enoxyphenyl)phenyl]-5-pentyl-1,3,4-thiadiazole |
| SMILES | CCCCC=CCOc1ccc(-c2ccc(-c3nnc(CCCCC)s3)cc2)cc1 |
| InChI | InChI=1S/C26H32N2OS/c1-3-5-7-8-10-20-29-24-18-16-22(17-19-24)21-12-14-23(15-13-21)26-28-27-25(30-26)11-9-6-4-2/h8,10,12-19H,3-7,9,11,20H2,1-2H3 |
| InChIKey | LZZUWDQQZWVJQK-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|