C25H32N2S — CID 101033956
2-(4-butylphenyl)-5-(4-heptylphenyl)-1,3,4-thiadiazole (PubChem CID 101033956) has the molecular formula C25H32N2S and a molecular weight of 392.61 g/mol. Its IUPAC name is 2-(4-butylphenyl)-5-(4-heptylphenyl)-1,3,4-thiadiazole.
| Compound Name | 2-(4-butylphenyl)-5-(4-heptylphenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 101033956 |
| Molecular Formula | C25H32N2S |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-(4-butylphenyl)-5-(4-heptylphenyl)-1,3,4-thiadiazole |
| SMILES | CCCCCCCc1ccc(-c2nnc(-c3ccc(CCCC)cc3)s2)cc1 |
| InChI | InChI=1S/C25H32N2S/c1-3-5-7-8-9-11-21-14-18-23(19-15-21)25-27-26-24(28-25)22-16-12-20(13-17-22)10-6-4-2/h12-19H,3-11H2,1-2H3 |
| InChIKey | PKMJIGWGKWETEZ-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|