C34H42Br2N2S2 — CID 122363279
4-bromo-5-[4-bromo-2-(4-octylphenyl)-1,3-thiazol-5-yl]-2-(4-octylphenyl)-1,3-thiazole (PubChem CID 122363279) has the molecular formula C34H42Br2N2S2 and a molecular weight of 702.67 g/mol. Its IUPAC name is 4-bromo-5-[4-bromo-2-(4-octylphenyl)-1,3-thiazol-5-yl]-2-(4-octylphenyl)-1,3-thiazole.
| Compound Name | 4-bromo-5-[4-bromo-2-(4-octylphenyl)-1,3-thiazol-5-yl]-2-(4-octylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 122363279 |
| Molecular Formula | C34H42Br2N2S2 |
| Molecular Weight | 702.67 g/mol |
| Exact Mass | 700.12 |
| IUPAC Name | 4-bromo-5-[4-bromo-2-(4-octylphenyl)-1,3-thiazol-5-yl]-2-(4-octylphenyl)-1,3-thiazole |
| SMILES | CCCCCCCCc1ccc(-c2nc(Br)c(-c3sc(-c4ccc(CCCCCCCC)cc4)nc3Br)s2)cc1 |
| InChI | InChI=1S/C34H42Br2N2S2/c1-3-5-7-9-11-13-15-25-17-21-27(22-18-25)33-37-31(35)29(39-33)30-32(36)38-34(40-30)28-23-19-26(20-24-28)16-14-12-10-8-6-4-2/h17-24H,3-16H2,1-2H3 |
| InChIKey | ANIHQJTVBYVCPF-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.67 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|