C23H28N2S — CID 54340876
2-(4-hexylphenyl)-5-(4-propylphenyl)-1,3,4-thiadiazole (PubChem CID 54340876) has the molecular formula C23H28N2S and a molecular weight of 364.56 g/mol. Its IUPAC name is 2-(4-hexylphenyl)-5-(4-propylphenyl)-1,3,4-thiadiazole.
| Compound Name | 2-(4-hexylphenyl)-5-(4-propylphenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 54340876 |
| Molecular Formula | C23H28N2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 2-(4-hexylphenyl)-5-(4-propylphenyl)-1,3,4-thiadiazole |
| SMILES | CCCCCCc1ccc(-c2nnc(-c3ccc(CCC)cc3)s2)cc1 |
| InChI | InChI=1S/C23H28N2S/c1-3-5-6-7-9-19-12-16-21(17-13-19)23-25-24-22(26-23)20-14-10-18(8-4-2)11-15-20/h10-17H,3-9H2,1-2H3 |
| InChIKey | TYWCKSXQJRGCAP-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|