C33H48N4O2S — CID 102093355
(4-decoxyphenyl)-[5-(4-nonoxyphenyl)-1,3,4-thiadiazol-2-yl]diazene (PubChem CID 102093355) has the molecular formula C33H48N4O2S and a molecular weight of 564.84 g/mol. Its IUPAC name is (4-decoxyphenyl)-[5-(4-nonoxyphenyl)-1,3,4-thiadiazol-2-yl]diazene.
| Compound Name | (4-decoxyphenyl)-[5-(4-nonoxyphenyl)-1,3,4-thiadiazol-2-yl]diazene |
|---|---|
| PubChem CID | 102093355 |
| Molecular Formula | C33H48N4O2S |
| Molecular Weight | 564.84 g/mol |
| Exact Mass | 564.35 |
| IUPAC Name | (4-decoxyphenyl)-[5-(4-nonoxyphenyl)-1,3,4-thiadiazol-2-yl]diazene |
| SMILES | CCCCCCCCCCOc1ccc(/N=N/c2nnc(-c3ccc(OCCCCCCCCC)cc3)s2)cc1 |
| InChI | InChI=1S/C33H48N4O2S/c1-3-5-7-9-11-13-15-17-27-39-31-24-20-29(21-25-31)34-36-33-37-35-32(40-33)28-18-22-30(23-19-28)38-26-16-14-12-10-8-6-4-2/h18-25H,3-17,26-27H2,1-2H3/b36-34+ |
| InChIKey | OGACFGNCWDDNQQ-JMUUFCRMSA-N |
| XLogP | 11.27 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.84 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|