C31H43N3O3S — CID 177478142
5-octoxy-2-[(E)-[5-(4-octoxyphenyl)-1,3,4-thiadiazol-2-yl]iminomethyl]phenol (PubChem CID 177478142) has the molecular formula C31H43N3O3S and a molecular weight of 537.77 g/mol. Its IUPAC name is 5-octoxy-2-[(E)-[5-(4-octoxyphenyl)-1,3,4-thiadiazol-2-yl]iminomethyl]phenol.
| Compound Name | 5-octoxy-2-[(E)-[5-(4-octoxyphenyl)-1,3,4-thiadiazol-2-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 177478142 |
| Molecular Formula | C31H43N3O3S |
| Molecular Weight | 537.77 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | 5-octoxy-2-[(E)-[5-(4-octoxyphenyl)-1,3,4-thiadiazol-2-yl]iminomethyl]phenol |
| SMILES | CCCCCCCCOc1ccc(-c2nnc(/N=C/c3ccc(OCCCCCCCC)cc3O)s2)cc1 |
| InChI | InChI=1S/C31H43N3O3S/c1-3-5-7-9-11-13-21-36-27-18-15-25(16-19-27)30-33-34-31(38-30)32-24-26-17-20-28(23-29(26)35)37-22-14-12-10-8-6-4-2/h15-20,23-24,35H,3-14,21-22H2,1-2H3/b32-24+ |
| InChIKey | BLNHPJQBFOGSCY-FEZSWGLMSA-N |
| XLogP | 9.14 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.77 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|