C21H25N5OS — CID 101148826
(4-octoxyphenyl)-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)diazene (PubChem CID 101148826) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is (4-octoxyphenyl)-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)diazene.
| Compound Name | (4-octoxyphenyl)-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)diazene |
|---|---|
| PubChem CID | 101148826 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (4-octoxyphenyl)-(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)diazene |
| SMILES | CCCCCCCCOc1ccc(/N=N/c2nnc(-c3ccncc3)s2)cc1 |
| InChI | InChI=1S/C21H25N5OS/c1-2-3-4-5-6-7-16-27-19-10-8-18(9-11-19)23-25-21-26-24-20(28-21)17-12-14-22-15-13-17/h8-15H,2-7,16H2,1H3/b25-23+ |
| InChIKey | FKLUUJNZQUJLFF-WJTDDFOZSA-N |
| XLogP | 6.75 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|