C21H30N2O3S — CID 102382417
butyl 5-(4-octoxyphenyl)-1,3,4-thiadiazole-2-carboxylate (PubChem CID 102382417) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is butyl 5-(4-octoxyphenyl)-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | butyl 5-(4-octoxyphenyl)-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 102382417 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | butyl 5-(4-octoxyphenyl)-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCCCCCCCOc1ccc(-c2nnc(C(=O)OCCCC)s2)cc1 |
| InChI | InChI=1S/C21H30N2O3S/c1-3-5-7-8-9-10-16-25-18-13-11-17(12-14-18)19-22-23-20(27-19)21(24)26-15-6-4-2/h11-14H,3-10,15-16H2,1-2H3 |
| InChIKey | YVTPYUNDUXMXNU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|