C24H28N2O3S — CID 21182349
methyl 4-[5-(4-octoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate (PubChem CID 21182349) has the molecular formula C24H28N2O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is methyl 4-[5-(4-octoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate.
| Compound Name | methyl 4-[5-(4-octoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 21182349 |
| Molecular Formula | C24H28N2O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | methyl 4-[5-(4-octoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate |
| SMILES | CCCCCCCCOc1ccc(-c2nnc(-c3ccc(C(=O)OC)cc3)s2)cc1 |
| InChI | InChI=1S/C24H28N2O3S/c1-3-4-5-6-7-8-17-29-21-15-13-19(14-16-21)23-26-25-22(30-23)18-9-11-20(12-10-18)24(27)28-2/h9-16H,3-8,17H2,1-2H3 |
| InChIKey | STVQTTOMZHKZQJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|