C41H60O6 — CID 19938923
2-[4-[3-(4-propylcyclohexyl)propoxy]benzoyl]oxypropyl 4-[3-(4-propylcyclohexyl)propoxy]benzoate (PubChem CID 19938923) has the molecular formula C41H60O6 and a molecular weight of 648.93 g/mol. Its IUPAC name is 2-[4-[3-(4-propylcyclohexyl)propoxy]benzoyl]oxypropyl 4-[3-(4-propylcyclohexyl)propoxy]benzoate.
| Compound Name | 2-[4-[3-(4-propylcyclohexyl)propoxy]benzoyl]oxypropyl 4-[3-(4-propylcyclohexyl)propoxy]benzoate |
|---|---|
| PubChem CID | 19938923 |
| Molecular Formula | C41H60O6 |
| Molecular Weight | 648.93 g/mol |
| Exact Mass | 648.44 |
| IUPAC Name | 2-[4-[3-(4-propylcyclohexyl)propoxy]benzoyl]oxypropyl 4-[3-(4-propylcyclohexyl)propoxy]benzoate |
| SMILES | CCCC1CCC(CCCOc2ccc(C(=O)OCC(C)OC(=O)c3ccc(OCCCC4CCC(CCC)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C41H60O6/c1-4-8-32-12-16-34(17-13-32)10-6-28-44-38-24-20-36(21-25-38)40(42)46-30-31(3)47-41(43)37-22-26-39(27-23-37)45-29-7-11-35-18-14-33(9-5-2)15-19-35/h20-27,31-35H,4-19,28-30H2,1-3H3 |
| InChIKey | KWLJKAUTCZXHFL-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.93 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|