C30H40O4 — CID 54142855
[4-[3-(4-propylcyclohexyl)propoxy]phenyl] 4-pent-4-enoxybenzoate (PubChem CID 54142855) has the molecular formula C30H40O4 and a molecular weight of 464.65 g/mol. Its IUPAC name is [4-[3-(4-propylcyclohexyl)propoxy]phenyl] 4-pent-4-enoxybenzoate.
| Compound Name | [4-[3-(4-propylcyclohexyl)propoxy]phenyl] 4-pent-4-enoxybenzoate |
|---|---|
| PubChem CID | 54142855 |
| Molecular Formula | C30H40O4 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | [4-[3-(4-propylcyclohexyl)propoxy]phenyl] 4-pent-4-enoxybenzoate |
| SMILES | C=CCCCOc1ccc(C(=O)Oc2ccc(OCCCC3CCC(CCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H40O4/c1-3-5-6-22-32-27-16-14-26(15-17-27)30(31)34-29-20-18-28(19-21-29)33-23-7-9-25-12-10-24(8-4-2)11-13-25/h3,14-21,24-25H,1,4-13,22-23H2,2H3 |
| InChIKey | OCHHCVSVARODMJ-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|