C30H42O6S — CID 143467719
[4-(4-propylcyclohexyl)phenyl] 4-[6-[ethenyl(dihydroxy)-λ4-sulfanyl]oxyhexoxy]benzoate (PubChem CID 143467719) has the molecular formula C30H42O6S and a molecular weight of 530.73 g/mol. Its IUPAC name is [4-(4-propylcyclohexyl)phenyl] 4-[6-[ethenyl(dihydroxy)-λ4-sulfanyl]oxyhexoxy]benzoate.
| Compound Name | [4-(4-propylcyclohexyl)phenyl] 4-[6-[ethenyl(dihydroxy)-λ4-sulfanyl]oxyhexoxy]benzoate |
|---|---|
| PubChem CID | 143467719 |
| Molecular Formula | C30H42O6S |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | [4-(4-propylcyclohexyl)phenyl] 4-[6-[ethenyl(dihydroxy)-λ4-sulfanyl]oxyhexoxy]benzoate |
| SMILES | C=CS(O)(O)OCCCCCCOc1ccc(C(=O)Oc2ccc(C3CCC(CCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C30H42O6S/c1-3-9-24-10-12-25(13-11-24)26-14-20-29(21-15-26)36-30(31)27-16-18-28(19-17-27)34-22-7-5-6-8-23-35-37(32,33)4-2/h4,14-21,24-25,32-33H,2-3,5-13,22-23H2,1H3 |
| InChIKey | OZWBTBSNSZXXPD-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|