C28H34O5 — CID 134235754
[4-(4-propylcyclohexyl)phenyl] 4-[2-(2-oxobut-3-enoxy)ethoxy]benzoate (PubChem CID 134235754) has the molecular formula C28H34O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is [4-(4-propylcyclohexyl)phenyl] 4-[2-(2-oxobut-3-enoxy)ethoxy]benzoate.
| Compound Name | [4-(4-propylcyclohexyl)phenyl] 4-[2-(2-oxobut-3-enoxy)ethoxy]benzoate |
|---|---|
| PubChem CID | 134235754 |
| Molecular Formula | C28H34O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | [4-(4-propylcyclohexyl)phenyl] 4-[2-(2-oxobut-3-enoxy)ethoxy]benzoate |
| SMILES | C=CC(=O)COCCOc1ccc(C(=O)Oc2ccc(C3CCC(CCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C28H34O5/c1-3-5-21-6-8-22(9-7-21)23-10-16-27(17-11-23)33-28(30)24-12-14-26(15-13-24)32-19-18-31-20-25(29)4-2/h4,10-17,21-22H,2-3,5-9,18-20H2,1H3 |
| InChIKey | ODDASACEOPBXLU-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|