C23H28O2 — CID 3093775
[4-(4-propylcyclohexyl)phenyl] 4-methylbenzoate (PubChem CID 3093775) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is [4-(4-propylcyclohexyl)phenyl] 4-methylbenzoate.
| Compound Name | [4-(4-propylcyclohexyl)phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 3093775 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | [4-(4-propylcyclohexyl)phenyl] 4-methylbenzoate |
| SMILES | CCCC1CCC(c2ccc(OC(=O)c3ccc(C)cc3)cc2)CC1 |
| InChI | InChI=1S/C23H28O2/c1-3-4-18-7-11-19(12-8-18)20-13-15-22(16-14-20)25-23(24)21-9-5-17(2)6-10-21/h5-6,9-10,13-16,18-19H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | BSMNCEKAWHCQMZ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|