C27H34O2 — CID 142331705
(4-prop-1-en-2-ylphenyl) 4-(4-pentylcyclohexyl)benzoate (PubChem CID 142331705) has the molecular formula C27H34O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is (4-prop-1-en-2-ylphenyl) 4-(4-pentylcyclohexyl)benzoate.
| Compound Name | (4-prop-1-en-2-ylphenyl) 4-(4-pentylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 142331705 |
| Molecular Formula | C27H34O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | (4-prop-1-en-2-ylphenyl) 4-(4-pentylcyclohexyl)benzoate |
| SMILES | C=C(C)c1ccc(OC(=O)c2ccc(C3CCC(CCCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H34O2/c1-4-5-6-7-21-8-10-23(11-9-21)24-12-14-25(15-13-24)27(28)29-26-18-16-22(17-19-26)20(2)3/h12-19,21,23H,2,4-11H2,1,3H3 |
| InChIKey | OPDCTJUQQHQVHK-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|