C34H49NO — CID 142282808
nitroxyl;1-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]-4-(4-prop-1-en-2-ylphenyl)benzene (PubChem CID 142282808) has the molecular formula C34H49NO and a molecular weight of 487.77 g/mol. Its IUPAC name is nitroxyl;1-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]-4-(4-prop-1-en-2-ylphenyl)benzene.
| Compound Name | nitroxyl;1-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]-4-(4-prop-1-en-2-ylphenyl)benzene |
|---|---|
| PubChem CID | 142282808 |
| Molecular Formula | C34H49NO |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 487.38 |
| IUPAC Name | nitroxyl;1-[4-[2-(4-pentylcyclohexyl)ethyl]cyclohexyl]-4-(4-prop-1-en-2-ylphenyl)benzene |
| SMILES | C=C(C)c1ccc(-c2ccc(C3CCC(CCC4CCC(CCCCC)CC4)CC3)cc2)cc1.N=O |
| InChI | InChI=1S/C34H48.HNO/c1-4-5-6-7-27-8-10-28(11-9-27)12-13-29-14-16-31(17-15-29)33-22-24-34(25-23-33)32-20-18-30(19-21-32)26(2)3;1-2/h18-25,27-29,31H,2,4-17H2,1,3H3;1H |
| InChIKey | ZUSAIEZETMXGKD-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|