C29H39NO — CID 134245611
N-[4-[4-(4-heptylcyclohexyl)phenyl]phenyl]-2-methylprop-2-enamide (PubChem CID 134245611) has the molecular formula C29H39NO and a molecular weight of 417.64 g/mol. Its IUPAC name is N-[4-[4-(4-heptylcyclohexyl)phenyl]phenyl]-2-methylprop-2-enamide.
| Compound Name | N-[4-[4-(4-heptylcyclohexyl)phenyl]phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 134245611 |
| Molecular Formula | C29H39NO |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | N-[4-[4-(4-heptylcyclohexyl)phenyl]phenyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1ccc(-c2ccc(C3CCC(CCCCCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C29H39NO/c1-4-5-6-7-8-9-23-10-12-24(13-11-23)25-14-16-26(17-15-25)27-18-20-28(21-19-27)30-29(31)22(2)3/h14-21,23-24H,2,4-13H2,1,3H3,(H,30,31) |
| InChIKey | NKKIKUCKOVUATK-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|