C26H41NO — CID 134246486
N-[3-[4-(4-heptylcyclohexyl)phenyl]propyl]-2-methylprop-2-enamide (PubChem CID 134246486) has the molecular formula C26H41NO and a molecular weight of 383.62 g/mol. Its IUPAC name is N-[3-[4-(4-heptylcyclohexyl)phenyl]propyl]-2-methylprop-2-enamide.
| Compound Name | N-[3-[4-(4-heptylcyclohexyl)phenyl]propyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 134246486 |
| Molecular Formula | C26H41NO |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.32 |
| IUPAC Name | N-[3-[4-(4-heptylcyclohexyl)phenyl]propyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCc1ccc(C2CCC(CCCCCCC)CC2)cc1 |
| InChI | InChI=1S/C26H41NO/c1-4-5-6-7-8-10-22-12-16-24(17-13-22)25-18-14-23(15-19-25)11-9-20-27-26(28)21(2)3/h14-15,18-19,22,24H,2,4-13,16-17,20H2,1,3H3,(H,27,28) |
| InChIKey | DWQWPPAUPXEGTF-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|