C34H53NO — CID 145235126
1-(4-heptylcyclohexyl)-4-(4-propylphenyl)benzene;N-methylformamide;2-methylprop-1-ene (PubChem CID 145235126) has the molecular formula C34H53NO and a molecular weight of 491.80 g/mol. Its IUPAC name is 1-(4-heptylcyclohexyl)-4-(4-propylphenyl)benzene;N-methylformamide;2-methylprop-1-ene.
| Compound Name | 1-(4-heptylcyclohexyl)-4-(4-propylphenyl)benzene;N-methylformamide;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145235126 |
| Molecular Formula | C34H53NO |
| Molecular Weight | 491.80 g/mol |
| Exact Mass | 491.41 |
| IUPAC Name | 1-(4-heptylcyclohexyl)-4-(4-propylphenyl)benzene;N-methylformamide;2-methylprop-1-ene |
| SMILES | C=C(C)C.CCCCCCCC1CCC(c2ccc(-c3ccc(CCC)cc3)cc2)CC1.CNC=O |
| InChI | InChI=1S/C28H40.C4H8.C2H5NO/c1-3-5-6-7-8-10-24-13-17-26(18-14-24)28-21-19-27(20-22-28)25-15-11-23(9-4-2)12-16-25;1-4(2)3;1-3-2-4/h11-12,15-16,19-22,24,26H,3-10,13-14,17-18H2,1-2H3;1H2,2-3H3;2H,1H3,(H,3,4) |
| InChIKey | AGOYNXZOPTUFME-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.80 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|