C30H51NO — CID 142282678
formaldehyde;methanamine;1-(3-methylbut-3-enyl)-4-[4-(4-pentylcyclohexyl)cyclohexyl]benzene (PubChem CID 142282678) has the molecular formula C30H51NO and a molecular weight of 441.74 g/mol. Its IUPAC name is formaldehyde;methanamine;1-(3-methylbut-3-enyl)-4-[4-(4-pentylcyclohexyl)cyclohexyl]benzene.
| Compound Name | formaldehyde;methanamine;1-(3-methylbut-3-enyl)-4-[4-(4-pentylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 142282678 |
| Molecular Formula | C30H51NO |
| Molecular Weight | 441.74 g/mol |
| Exact Mass | 441.40 |
| IUPAC Name | formaldehyde;methanamine;1-(3-methylbut-3-enyl)-4-[4-(4-pentylcyclohexyl)cyclohexyl]benzene |
| SMILES | C=C(C)CCc1ccc(C2CCC(C3CCC(CCCCC)CC3)CC2)cc1.C=O.CN |
| InChI | InChI=1S/C28H44.CH5N.CH2O/c1-4-5-6-7-23-10-14-25(15-11-23)27-18-20-28(21-19-27)26-16-12-24(13-17-26)9-8-22(2)3;2*1-2/h12-13,16-17,23,25,27-28H,2,4-11,14-15,18-21H2,1,3H3;2H2,1H3;1H2 |
| InChIKey | GRQOCMKMOKSFCI-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.74 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|