C23H36O2 — CID 138529185
ethyl 4-[4-(4-pentylcyclohexyl)phenyl]butanoate (PubChem CID 138529185) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is ethyl 4-[4-(4-pentylcyclohexyl)phenyl]butanoate.
| Compound Name | ethyl 4-[4-(4-pentylcyclohexyl)phenyl]butanoate |
|---|---|
| PubChem CID | 138529185 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | ethyl 4-[4-(4-pentylcyclohexyl)phenyl]butanoate |
| SMILES | CCCCCC1CCC(c2ccc(CCCC(=O)OCC)cc2)CC1 |
| InChI | InChI=1S/C23H36O2/c1-3-5-6-8-19-11-15-21(16-12-19)22-17-13-20(14-18-22)9-7-10-23(24)25-4-2/h13-14,17-19,21H,3-12,15-16H2,1-2H3 |
| InChIKey | WAWDPHGSHJFWFD-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|