C30H47NO — CID 134246489
N,2-dimethyl-N-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]prop-2-enamide (PubChem CID 134246489) has the molecular formula C30H47NO and a molecular weight of 437.71 g/mol. Its IUPAC name is N,2-dimethyl-N-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]prop-2-enamide.
| Compound Name | N,2-dimethyl-N-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 134246489 |
| Molecular Formula | C30H47NO |
| Molecular Weight | 437.71 g/mol |
| Exact Mass | 437.37 |
| IUPAC Name | N,2-dimethyl-N-[2-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenyl]ethyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)CCc1ccc(C2CCC(C3CCC(CCCCC)CC3)CC2)cc1 |
| InChI | InChI=1S/C30H47NO/c1-5-6-7-8-24-9-13-26(14-10-24)28-17-19-29(20-18-28)27-15-11-25(12-16-27)21-22-31(4)30(32)23(2)3/h11-12,15-16,24,26,28-29H,2,5-10,13-14,17-22H2,1,3-4H3 |
| InChIKey | WKXBKOFFTCKQAH-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.71 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|