C32H45NO — CID 134245513
N-methyl-N-[3-[4-[2-[4-(4-pentylcyclohexyl)phenyl]ethyl]phenyl]propyl]prop-2-enamide (PubChem CID 134245513) has the molecular formula C32H45NO and a molecular weight of 459.72 g/mol. Its IUPAC name is N-methyl-N-[3-[4-[2-[4-(4-pentylcyclohexyl)phenyl]ethyl]phenyl]propyl]prop-2-enamide.
| Compound Name | N-methyl-N-[3-[4-[2-[4-(4-pentylcyclohexyl)phenyl]ethyl]phenyl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 134245513 |
| Molecular Formula | C32H45NO |
| Molecular Weight | 459.72 g/mol |
| Exact Mass | 459.35 |
| IUPAC Name | N-methyl-N-[3-[4-[2-[4-(4-pentylcyclohexyl)phenyl]ethyl]phenyl]propyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)CCCc1ccc(CCc2ccc(C3CCC(CCCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C32H45NO/c1-4-6-7-9-26-17-21-30(22-18-26)31-23-19-29(20-24-31)16-15-28-13-11-27(12-14-28)10-8-25-33(3)32(34)5-2/h5,11-14,19-20,23-24,26,30H,2,4,6-10,15-18,21-22,25H2,1,3H3 |
| InChIKey | MBUIYFKMXAXRKU-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.72 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|