C22H33NO — CID 134245404
N-methyl-N-[[4-(4-pentylcyclohexyl)phenyl]methyl]prop-2-enamide (PubChem CID 134245404) has the molecular formula C22H33NO and a molecular weight of 327.51 g/mol. Its IUPAC name is N-methyl-N-[[4-(4-pentylcyclohexyl)phenyl]methyl]prop-2-enamide.
| Compound Name | N-methyl-N-[[4-(4-pentylcyclohexyl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 134245404 |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | N-methyl-N-[[4-(4-pentylcyclohexyl)phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)N(C)Cc1ccc(C2CCC(CCCCC)CC2)cc1 |
| InChI | InChI=1S/C22H33NO/c1-4-6-7-8-18-9-13-20(14-10-18)21-15-11-19(12-16-21)17-23(3)22(24)5-2/h5,11-12,15-16,18,20H,2,4,6-10,13-14,17H2,1,3H3 |
| InChIKey | NSDWSAGOSCXGHQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|