C25H41NO2 — CID 142282750
2-[(dimethylamino)methyl]prop-2-enal;4-(4-heptylcyclohexyl)phenol (PubChem CID 142282750) has the molecular formula C25H41NO2 and a molecular weight of 387.61 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]prop-2-enal;4-(4-heptylcyclohexyl)phenol.
| Compound Name | 2-[(dimethylamino)methyl]prop-2-enal;4-(4-heptylcyclohexyl)phenol |
|---|---|
| PubChem CID | 142282750 |
| Molecular Formula | C25H41NO2 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.31 |
| IUPAC Name | 2-[(dimethylamino)methyl]prop-2-enal;4-(4-heptylcyclohexyl)phenol |
| SMILES | C=C(C=O)CN(C)C.CCCCCCCC1CCC(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C19H30O.C6H11NO/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)18-12-14-19(20)15-13-18;1-6(5-8)4-7(2)3/h12-17,20H,2-11H2,1H3;5H,1,4H2,2-3H3 |
| InChIKey | PYQCUEQLZQRCPO-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|