C24H38O3 — CID 142282298
1-(4-heptylcyclohexyl)-4-methoxybenzene;2-(hydroxymethyl)prop-2-enal (PubChem CID 142282298) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is 1-(4-heptylcyclohexyl)-4-methoxybenzene;2-(hydroxymethyl)prop-2-enal.
| Compound Name | 1-(4-heptylcyclohexyl)-4-methoxybenzene;2-(hydroxymethyl)prop-2-enal |
|---|---|
| PubChem CID | 142282298 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | 1-(4-heptylcyclohexyl)-4-methoxybenzene;2-(hydroxymethyl)prop-2-enal |
| SMILES | C=C(C=O)CO.CCCCCCCC1CCC(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C20H32O.C4H6O2/c1-3-4-5-6-7-8-17-9-11-18(12-10-17)19-13-15-20(21-2)16-14-19;1-4(2-5)3-6/h13-18H,3-12H2,1-2H3;2,6H,1,3H2 |
| InChIKey | LESLKINTSGXWJY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|