C38H54O6 — CID 145411556
2-(hydroxymethyl)prop-2-enal;[3-hydroxy-2-[4-[6-(4-pentylcyclohexyl)naphthalen-2-yl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 145411556) has the molecular formula C38H54O6 and a molecular weight of 606.84 g/mol. Its IUPAC name is 2-(hydroxymethyl)prop-2-enal;[3-hydroxy-2-[4-[6-(4-pentylcyclohexyl)naphthalen-2-yl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | 2-(hydroxymethyl)prop-2-enal;[3-hydroxy-2-[4-[6-(4-pentylcyclohexyl)naphthalen-2-yl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 145411556 |
| Molecular Formula | C38H54O6 |
| Molecular Weight | 606.84 g/mol |
| Exact Mass | 606.39 |
| IUPAC Name | 2-(hydroxymethyl)prop-2-enal;[3-hydroxy-2-[4-[6-(4-pentylcyclohexyl)naphthalen-2-yl]cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C=O)CO.C=C(CO)C(=O)OCC(CO)C1CCC(c2ccc3cc(C4CCC(CCCCC)CC4)ccc3c2)CC1 |
| InChI | InChI=1S/C34H48O4.C4H6O2/c1-3-4-5-6-25-7-9-26(10-8-25)29-15-17-32-20-30(16-18-31(32)19-29)27-11-13-28(14-12-27)33(22-36)23-38-34(37)24(2)21-35;1-4(2-5)3-6/h15-20,25-28,33,35-36H,2-14,21-23H2,1H3;2,6H,1,3H2 |
| InChIKey | GXJBMMLFSPMRPM-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.84 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|