C33H44O5 — CID 134245693
[2-(2-methylprop-2-enoyloxymethyl)-3-[4-(6-pentylnaphthalen-2-yl)cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 134245693) has the molecular formula C33H44O5 and a molecular weight of 520.71 g/mol. Its IUPAC name is [2-(2-methylprop-2-enoyloxymethyl)-3-[4-(6-pentylnaphthalen-2-yl)cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [2-(2-methylprop-2-enoyloxymethyl)-3-[4-(6-pentylnaphthalen-2-yl)cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 134245693 |
| Molecular Formula | C33H44O5 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | [2-(2-methylprop-2-enoyloxymethyl)-3-[4-(6-pentylnaphthalen-2-yl)cyclohexyl]propyl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)CO)CC1CCC(c2ccc3cc(CCCCC)ccc3c2)CC1 |
| InChI | InChI=1S/C33H44O5/c1-5-6-7-8-25-11-14-31-19-30(16-15-29(31)18-25)28-12-9-26(10-13-28)17-27(21-37-32(35)23(2)3)22-38-33(36)24(4)20-34/h11,14-16,18-19,26-28,34H,2,4-10,12-13,17,20-22H2,1,3H3 |
| InChIKey | MCLHPOWQOZGXIX-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|