C42H62O4 — CID 134244714
[2-[[4-[4-[3-ethyl-4-(4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]methyl]-3-(3-hydroxypropoxy)propyl] 2-methylprop-2-enoate (PubChem CID 134244714) has the molecular formula C42H62O4 and a molecular weight of 630.95 g/mol. Its IUPAC name is [2-[[4-[4-[3-ethyl-4-(4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]methyl]-3-(3-hydroxypropoxy)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[4-[4-[3-ethyl-4-(4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]methyl]-3-(3-hydroxypropoxy)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134244714 |
| Molecular Formula | C42H62O4 |
| Molecular Weight | 630.95 g/mol |
| Exact Mass | 630.46 |
| IUPAC Name | [2-[[4-[4-[3-ethyl-4-(4-pentylphenyl)phenyl]cyclohexyl]cyclohexyl]methyl]-3-(3-hydroxypropoxy)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COCCCO)CC1CCC(C2CCC(c3ccc(-c4ccc(CCCCC)cc4)c(CC)c3)CC2)CC1 |
| InChI | InChI=1S/C42H62O4/c1-5-7-8-10-32-11-17-39(18-12-32)41-24-23-40(28-35(41)6-2)38-21-19-37(20-22-38)36-15-13-33(14-16-36)27-34(29-45-26-9-25-43)30-46-42(44)31(3)4/h11-12,17-18,23-24,28,33-34,36-38,43H,3,5-10,13-16,19-22,25-27,29-30H2,1-2,4H3 |
| InChIKey | QGIMMXKDPDWYRB-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.95 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|