C42H52O7 — CID 145122647
2-[5-[2-ethyl-4-(4-methylcyclohexyl)phenyl]-2-[4-(3-hydroxypropyl)phenyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 145122647) has the molecular formula C42H52O7 and a molecular weight of 668.87 g/mol. Its IUPAC name is 2-[5-[2-ethyl-4-(4-methylcyclohexyl)phenyl]-2-[4-(3-hydroxypropyl)phenyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[5-[2-ethyl-4-(4-methylcyclohexyl)phenyl]-2-[4-(3-hydroxypropyl)phenyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 145122647 |
| Molecular Formula | C42H52O7 |
| Molecular Weight | 668.87 g/mol |
| Exact Mass | 668.37 |
| IUPAC Name | 2-[5-[2-ethyl-4-(4-methylcyclohexyl)phenyl]-2-[4-(3-hydroxypropyl)phenyl]-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(-c2ccc(C3CCC(C)CC3)cc2CC)c(OCCOC(=O)C(=C)C)cc1-c1ccc(CCCO)cc1 |
| InChI | InChI=1S/C42H52O7/c1-7-32-25-35(33-14-10-30(6)11-15-33)18-19-36(32)38-27-39(46-21-23-48-41(44)28(2)3)37(34-16-12-31(13-17-34)9-8-20-43)26-40(38)47-22-24-49-42(45)29(4)5/h12-13,16-19,25-27,30,33,43H,2,4,7-11,14-15,20-24H2,1,3,5-6H3 |
| InChIKey | VXODXAXATIDRGQ-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.87 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|