C44H55FO7 — CID 134193849
2-[5-[2-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-(3-hydroxypropyl)-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 134193849) has the molecular formula C44H55FO7 and a molecular weight of 714.91 g/mol. Its IUPAC name is 2-[5-[2-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-(3-hydroxypropyl)-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[5-[2-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-(3-hydroxypropyl)-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134193849 |
| Molecular Formula | C44H55FO7 |
| Molecular Weight | 714.91 g/mol |
| Exact Mass | 714.39 |
| IUPAC Name | 2-[5-[2-fluoro-4-[4-(4-pentylcyclohexyl)phenyl]phenyl]-2-(3-hydroxypropyl)-4-[2-(2-methylprop-2-enoyloxy)ethoxy]phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOc1cc(-c2ccc(-c3ccc(C4CCC(CCCCC)CC4)cc3)cc2F)c(OCCOC(=O)C(=C)C)cc1CCCO |
| InChI | InChI=1S/C44H55FO7/c1-6-7-8-10-32-12-14-33(15-13-32)34-16-18-35(19-17-34)36-20-21-38(40(45)27-36)39-29-41(49-23-25-51-43(47)30(2)3)37(11-9-22-46)28-42(39)50-24-26-52-44(48)31(4)5/h16-21,27-29,32-33,46H,2,4,6-15,22-26H2,1,3,5H3 |
| InChIKey | WXODWRDHLXIXMS-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.91 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|